Systematic / IUPAC Name: 6-(Dimethylamino)-2-fluoro-3-[(E)-(hydroxyimino)methyl]benzonitrile
ID: Reference3596
Other Names: Benzonitrile, 6-(dimethylamino)-2-fluoro-3-[(E)-(hydroxyimino)methyl]-
Formula: C10H10FN3O
6-(Dimethylamino)-2-fluoro-3-(hydroxyiminomethyl)benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 771 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 1/14/2016 11:56:57 AM |
| InChI | InChI=1S/C10H10FN3O/c1-14(2)9-4-3-7(6-13-15)10(11)8(9)5-12/h3-4,6,15H,1-2H3/b13-6+ |
| InChI Key | ZAJQYCSLHIXNKN-AWNIVKPZSA-N |
| Canonical SMILES | CN(C)C1=C(C(=C(C=C1)C=NO)F)C#N |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 6-(dimethylamino)-2-fluoro-3-[(E)-(hydroxyimino)methyl]- |