Systematic / IUPAC Name: 3-[({2-[(2,4-Dichlorophenyl)sulfonyl]ethyl}sulfanyl)methyl]-1-benzothiophene
ID: Reference3601
Other Names: Benzo[b]thiophene, 3-[({2-[(2,4-dichlorophenyl)sulfonyl]ethyl}thio)methyl]-
Formula: C17H14Cl2O2S3
3-[({2-[(2,4-Dichlorophenyl)sulfonyl]ethyl}sulfanyl)methyl]-1-benzothiophene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 90 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2016 12:17:58 PM |
| InChI | InChI=1S/C17H14Cl2O2S3/c18-13-5-6-17(15(19)9-13)24(20,21)8-7-22-10-12-11-23-16-4-2-1-3-14(12)16/h1-6,9,11H,7-8,10H2 |
| InChI Key | HUOOSGIEENAPCE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CS2)CSCCS(=O)(=O)C3=C(C=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Benzo[b]thiophene, 3-[({2-[(2,4-dichlorophenyl)sulfonyl]ethyl}thio)methyl]- |