Systematic / IUPAC Name: 1-(4-Methylphenyl)-3-(4-morpholinyl)-1-propanone
ID: Reference3603
Other Names: 3-Morpholino-1-p-tolylpropan-1-one
Formula: C14H19NO2
1-(4-methylphenyl)-3-morpholinopropan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 428 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 6:12:48 AM |
| InChI | InChI=1S/C14H19NO2/c1-12-2-4-13(5-3-12)14(16)6-7-15-8-10-17-11-9-15/h2-5H,6-11H2,1H3 |
| InChI Key | JGGCAYFMVBIPQG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)CCN2CCOCC2 |
| CAS | |
| Splash | |
| Other Names | 3-Morpholino-1-p-tolylpropan-1-one |
| ChEMBL | CHEMBL258985 |
| ChemSpider | 372553 |
| PubChem | 420859 |