Systematic / IUPAC Name: Methyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate
ID: Reference3604
Other Names:
3-Hydroxy-thieno[2,3-b]pyridine-2-carboxylic acid methyl ester;
Thieno[2,3-b]pyridine-2-carboxylic acid, 3-hydroxy-, methyl ester
Formula: C9H7NO3S
Methyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1094 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/14/2016 1:38:44 PM |
| InChI | InChI=1S/C9H7NO3S/c1-13-9(12)7-6(11)5-3-2-4-10-8(5)14-7/h2-4,11H,1H3 |
| InChI Key | VNGMVGWUWHNBBW-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=C(C2=C(S1)N=CC=C2)O |
| CAS | |
| Splash | |
| Other Names |
3-Hydroxy-thieno[2,3-b]pyridine-2-carboxylic acid methyl ester; Thieno[2,3-b]pyridine-2-carboxylic acid, 3-hydroxy-, methyl ester |