Systematic / IUPAC Name: 6-[5-(1-Naphthyl)-1,3,4-oxadiazol-2-yl]quinoxaline
ID: Reference3607
Other Names: Quinoxaline, 6-[5-(1-naphthalenyl)-1,3,4-oxadiazol-2-yl]-
Formula: C20H12N4O
6-[5-(1-Naphthyl)-1,3,4-oxadiazol-2-yl]quinoxaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 793 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/14/2016 3:29:22 PM |
| InChI | InChI=1S/C20H12N4O/c1-2-6-15-13(4-1)5-3-7-16(15)20-24-23-19(25-20)14-8-9-17-18(12-14)22-11-10-21-17/h1-12H |
| InChI Key | UZOBUFPTKLZGHJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NN=C(O3)C4=CC5=NC=CN=C5C=C4 |
| CAS | |
| Splash | |
| Other Names | Quinoxaline, 6-[5-(1-naphthalenyl)-1,3,4-oxadiazol-2-yl]- |