Systematic / IUPAC Name: [4-(9H-Fluoren-9-yl)-1-piperazinyl][4-methyl-2-(2-pyrazinyl)-1,3-thiazol-5-yl]methanone
ID: Reference3613
Other Names: Methanone, [4-(9H-fluoren-9-yl)-1-piperazinyl][4-methyl-2-(2-pyrazinyl)-5-thiazolyl]-
Formula: C26H23N5OS
[4-(9H-Fluoren-9-yl)piperazino][4-methyl-2-(2-pyrazinyl)-1,3-thiazol-5-yl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 970 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 9:00:45 AM |
| InChI | InChI=1S/C26H23N5OS/c1-17-24(33-25(29-17)22-16-27-10-11-28-22)26(32)31-14-12-30(13-15-31)23-20-8-4-2-6-18(20)19-7-3-5-9-21(19)23/h2-11,16,23H,12-15H2,1H3 |
| InChI Key | WHLUDDPSIUCGAG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=N1)C2=NC=CN=C2)C(=O)N3CCN(CC3)C4C5=CC=CC=C5C6=CC=CC=C46 |
| CAS | |
| Splash | |
| Other Names | Methanone, [4-(9H-fluoren-9-yl)-1-piperazinyl][4-methyl-2-(2-pyrazinyl)-5-thiazolyl]- |