Systematic / IUPAC Name: N-[3-(3-Acetamidophenoxy)propyl]-5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furamide
ID: Reference3615
Other Names:
3-Furancarboxamide, N-{3-[3-(acetylamino)phenoxy]propyl}-5-(4-chlorophenyl)-2-(trifluoromethyl)- ;
5-(4-Chlorophenyl)-N-[3-(3-acetamidophenoxy)propyl]-2-(trifluoromethyl)furan-3-carboxamide
Formula: C23H20ClF3N2O4
N-{3-[3-(Acetylamino)phenoxy]propyl}-5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 5072 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 12:39:19 PM |
| InChI | InChI=1S/C23H20ClF3N2O4/c1-14(30)29-17-4-2-5-18(12-17)32-11-3-10-28-22(31)19-13-20(33-21(19)23(25,26)27)15-6-8-16(24)9-7-15/h2,4-9,12-13H,3,10-11H2,1H3,(H,28,31)(H,29,30) |
| InChI Key | LJPMZNQWHPVKGR-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC(=CC=C1)OCCCNC(=O)C2=C(OC(=C2)C3=CC=C(C=C3)Cl)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
3-Furancarboxamide, N-{3-[3-(acetylamino)phenoxy]propyl}-5-(4-chlorophenyl)-2-(trifluoromethyl)- ; 5-(4-Chlorophenyl)-N-[3-(3-acetamidophenoxy)propyl]-2-(trifluoromethyl)furan-3-carboxamide |