Systematic / IUPAC Name: 2-{4-[3-(5-Fluoro-1H-indol-3-yl)propyl]-1-piperazinyl}-N-phenylacetamide
ID: Reference3616
Other Names: 1-Piperazineacetamide, 4-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-phenyl-
Formula: C23H27FN4O
2-{4-[3-(5-Fluoro-1H-indol-3-yl)propyl]piperazino}-N-phenylacetamide fumarate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1090 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 12:41:35 PM |
| InChI | InChI=1S/C23H27FN4O/c24-19-8-9-22-21(15-19)18(16-25-22)5-4-10-27-11-13-28(14-12-27)17-23(29)26-20-6-2-1-3-7-20/h1-3,6-9,15-16,25H,4-5,10-14,17H2,(H,26,29) |
| InChI Key | KVUBBFXCRWGLTA-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1CCCC2=CNC3=C2C=C(C=C3)F)CC(=O)NC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 1-Piperazineacetamide, 4-[3-(5-fluoro-1H-indol-3-yl)propyl]-N-phenyl- |