Systematic / IUPAC Name: 3-Chloro-N-[1-(2-furyl)ethyl]-N-(2-pyridinyl)-1-benzothiophene-2-carboxamide
ID: Reference3617
Other Names: 3-Chloro-N-[1-(furan-2-yl)ethyl]-N-(pyridin-2-yl)-1-benzothiophene-2-carboxamide
Formula: C20H15ClN2O2S
3-Chloro-N-[1-(2-furyl)ethyl]-N-pyridin-2-yl-1-benzothiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1348 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 10:06:07 AM |
| InChI | InChI=1S/C20H15ClN2O2S/c1-13(15-8-6-12-25-15)23(17-10-4-5-11-22-17)20(24)19-18(21)14-7-2-3-9-16(14)26-19/h2-13H,1H3 |
| InChI Key | MNIQJOXXAVZJTK-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=CO1)N(C2=CC=CC=N2)C(=O)C3=C(C4=CC=CC=C4S3)Cl |
| CAS | |
| Splash | |
| Other Names | 3-Chloro-N-[1-(furan-2-yl)ethyl]-N-(pyridin-2-yl)-1-benzothiophene-2-carboxamide |