Systematic / IUPAC Name: 6-Methoxy-2-(4-morpholinyl)-3-nitrobenzonitrile
ID: Reference3624
Other Names: Benzonitrile, 6-methoxy-2-(4-morpholinyl)-3-nitro-
Formula: C12H13N3O4
6-Methoxy-2-morpholino-3-nitrobenzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 1:53:04 PM |
| InChI | InChI=1S/C12H13N3O4/c1-18-11-3-2-10(15(16)17)12(9(11)8-13)14-4-6-19-7-5-14/h2-3H,4-7H2,1H3 |
| InChI Key | JNXAHODDPLIIRN-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzonitrile, 6-methoxy-2-(4-morpholinyl)-3-nitro- |