Systematic / IUPAC Name: Ethyl [3-(4-chlorophenyl)-2,4-dioxo-6-phenyl-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate
ID: Reference3625
Other Names: Thieno[2,3-d]pyrimidine-1(2H)-acetic acid, 3-(4-chlorophenyl)-3,4-dihydro-2,4-dioxo-6-phenyl-, ethyl ester
Formula: C22H17ClN2O4S
Ethyl 2-[3-(4-chlorophenyl)-2,4-dioxo-6-phenyl-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1978 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/15/2016 1:40:30 PM |
| InChI | InChI=1S/C22H17ClN2O4S/c1-2-29-19(26)13-24-21-17(12-18(30-21)14-6-4-3-5-7-14)20(27)25(22(24)28)16-10-8-15(23)9-11-16/h3-12H,2,13H2,1H3 |
| InChI Key | IVGIMQYJWQEKCW-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CN1C2=C(C=C(S2)C3=CC=CC=C3)C(=O)N(C1=O)C4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | Thieno[2,3-d]pyrimidine-1(2H)-acetic acid, 3-(4-chlorophenyl)-3,4-dihydro-2,4-dioxo-6-phenyl-, ethyl ester |