Systematic / IUPAC Name: 2-[(Pentamethylbenzyl)sulfanyl]acetohydrazide
ID: Reference3628
Other Names:
Acethydrazide, 2-(pentamethylbenzylthio)-;
2-[(2,3,4,5,6-Pentamethylbenzyl)sulfanyl]acetohydrazide
Formula: C14H22N2OS
2-[(2,3,4,5,6-Pentamethylbenzyl)thio]ethanohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 477 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/18/2016 8:11:10 AM |
| InChI | InChI=1S/C14H22N2OS/c1-8-9(2)11(4)13(12(5)10(8)3)6-18-7-14(17)16-15/h6-7,15H2,1-5H3,(H,16,17) |
| InChI Key | IKCNIXLVTFNALQ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=C(C(=C1C)C)CSCC(=O)NN)C)C |
| CAS | |
| Splash | |
| Other Names |
Acethydrazide, 2-(pentamethylbenzylthio)-; 2-[(2,3,4,5,6-Pentamethylbenzyl)sulfanyl]acetohydrazide |