Systematic / IUPAC Name: N-(2-Methoxy-5-methylphenyl)-2-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
ID: Reference3635
Other Names: Acetamide, N-(2-methoxy-5-methylphenyl)-2-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}-
Formula: C14H15F3N4O2S
N1-(2-Methoxy-5-methylphenyl)-2-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1684 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2016 10:59:36 AM |
| InChI | InChI=1S/C14H15F3N4O2S/c1-8-4-5-10(23-3)9(6-8)18-11(22)7-24-13-20-19-12(21(13)2)14(15,16)17/h4-6H,7H2,1-3H3,(H,18,22) |
| InChI Key | BBIZXRRIIUPEHO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1)OC)NC(=O)CSC2=NN=C(N2C)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(2-methoxy-5-methylphenyl)-2-{[4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]thio}- |