Systematic / IUPAC Name: Ethyl 3-{[3,5-bis(trifluoromethyl)phenyl]amino}-2-phenyl-3-(2-pyridinyl)propanoate
ID: Reference3636
Other Names: 2-Pyridinepropanoic acid, β-{[3,5-bis(trifluoromethyl)phenyl]amino}-α-phenyl-, ethyl ester
Formula: C24H20F6N2O2
Ethyl 3-[3,5-bis(trifluoromethyl)anilino]-2-phenyl-3-(2-pyridyl)propanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3069 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/18/2016 11:45:02 AM |
| InChI | InChI=1S/C24H20F6N2O2/c1-2-34-22(33)20(15-8-4-3-5-9-15)21(19-10-6-7-11-31-19)32-18-13-16(23(25,26)27)12-17(14-18)24(28,29)30/h3-14,20-21,32H,2H2,1H3 |
| InChI Key | HPFTYDULMIGYHR-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(C1=CC=CC=C1)C(C2=CC=CC=N2)NC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 2-Pyridinepropanoic acid, β-{[3,5-bis(trifluoromethyl)phenyl]amino}-α-phenyl-, ethyl ester |
| ChemSpider | 2082430 |
| PubChem | 2803847 |
| ChEMBL | CHEMBL1883065 |