Systematic / IUPAC Name: 4-Aminotetrahydro-2H-thiopyran-4-carboxylic acid
ID: Reference3637
Other Names:
2H-Thiopyran-4-carboxylic acid, 4-aminotetrahydro-;
4-Aminotetrahydrothiopyran-4-carboxylic acid;
4-Aminothiane-4-carboxylic acid;
4-Aminothiapyran-4-carboxylic acid
Formula: C6H11NO2S
4-Aminotetrahydro-2H-thiopyran-4-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 9:11:17 AM |
| InChI | InChI=1S/C6H11NO2S/c7-6(5(8)9)1-3-10-4-2-6/h1-4,7H2,(H,8,9) |
| InChI Key | WIPRZHGCPZSPLJ-UHFFFAOYSA-N |
| Canonical SMILES | C1CSCCC1(C(=O)O)N |
| CAS | 39124168 |
| Splash | |
| Other Names |
2H-Thiopyran-4-carboxylic acid, 4-aminotetrahydro-; 4-Aminotetrahydrothiopyran-4-carboxylic acid; 4-Aminothiane-4-carboxylic acid; 4-Aminothiapyran-4-carboxylic acid |
| ChemSpider | 298070 |
| ChEMBL | CHEMBL40198 |
| PubChem | 336313 |