Systematic / IUPAC Name: (5Z)-5-(2-Thienylmethylene)-2-thioxo-1,3-thiazolidin-4-one
ID: Reference3638
Other Names:
5-(2-Thenylidene)rhodanine;
(5Z)-2-Sulfanyl-5-(thiophen-2-ylmethylidene)-1,3-thiazol-4(5H)-one;
(5Z)-4-Hydroxy-5-(thiophen-2-ylmethylidene)-1,3-thiazole-2(5H)-thione;
(5Z)-5-(Thiophen-2-ylmethylidene)-2-thioxo-1,3-thiazolidin-4-one;
4-Thiazolidinone, 5-(2-thienylmethylene)-2-thioxo-
Formula: C8H5NOS3
5-(2-Thienylmethylidene)-2-thioxo-1,3-thiazolan-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 9:30:01 AM |
| InChI | InChI=1S/C8H5NOS3/c10-7-6(13-8(11)9-7)4-5-2-1-3-12-5/h1-4H,(H,9,10,11)/b6-4- |
| InChI Key | XLYORYAUKZCBPS-XQRVVYSFSA-N |
| Canonical SMILES | C1=CSC(=C1)C=C2C(=O)NC(=S)S2 |
| CAS | |
| Splash | |
| Other Names |
5-(2-Thenylidene)rhodanine; (5Z)-2-Sulfanyl-5-(thiophen-2-ylmethylidene)-1,3-thiazol-4(5H)-one; (5Z)-4-Hydroxy-5-(thiophen-2-ylmethylidene)-1,3-thiazole-2(5H)-thione; (5Z)-5-(Thiophen-2-ylmethylidene)-2-thioxo-1,3-thiazolidin-4-one; 4-Thiazolidinone, 5-(2-thienylmethylene)-2-thioxo- |
| PubChem | 1241133 |
| ChEMBL | CHEMBL1957779 |
| ChemSpider | 1042135 |