Systematic / IUPAC Name: Ethyl 5-ethyl-2-{[3-(trifluoromethyl)benzoyl]amino}-3-thiophenecarboxylate
ID: Reference3641
Other Names: 3-Thiophenecarboxylic acid, 5-ethyl-2-{[3-(trifluoromethyl)benzoyl]amino}-, ethyl ester
Formula: C17H16F3NO3S
Ethyl 5-ethyl-2-{[3-(trifluoromethyl)benzoyl]amino}thiophene-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 12:41:26 PM |
| InChI | InChI=1S/C17H16F3NO3S/c1-3-12-9-13(16(23)24-4-2)15(25-12)21-14(22)10-6-5-7-11(8-10)17(18,19)20/h5-9H,3-4H2,1-2H3,(H,21,22) |
| InChI Key | GKGMBAFSZNGCNW-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC(=C(S1)NC(=O)C2=CC(=CC=C2)C(F)(F)F)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names | 3-Thiophenecarboxylic acid, 5-ethyl-2-{[3-(trifluoromethyl)benzoyl]amino}-, ethyl ester |