Systematic / IUPAC Name: N-(Cyclopropylmethyl)-2,4-difluorobenzenesulfonamide
ID: Reference3643
Other Names: Benzenesulfonamide, N-(cyclopropylmethyl)-2,4-difluoro-
Formula: C10H11F2NO2S
N1-Cyclopropylmethyl-2,4-difluorobenzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 2:45:23 PM |
| InChI | InChI=1S/C10H11F2NO2S/c11-8-3-4-10(9(12)5-8)16(14,15)13-6-7-1-2-7/h3-5,7,13H,1-2,6H2 |
| InChI Key | GWXJVQJJOBDPMG-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1CNS(=O)(=O)C2=C(C=C(C=C2)F)F |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-(cyclopropylmethyl)-2,4-difluoro- |