Systematic / IUPAC Name: 2-{1-[(4-Chlorophenyl)sulfonyl]-1H-pyrrol-3-yl}quinoxaline
ID: Reference3649
Other Names: Quinoxaline, 2-{1-[(4-chlorophenyl)sulfonyl]-1H-pyrrol-3-yl}-
Formula: C18H12ClN3O2S
2-{1-[(4-Chlorophenyl)sulfonyl]-1H-pyrrol-3-yl}quinoxaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/28/2016 11:37:40 AM |
| InChI | InChI=1S/C18H12ClN3O2S/c19-14-5-7-15(8-6-14)25(23,24)22-10-9-13(12-22)18-11-20-16-3-1-2-4-17(16)21-18/h1-12H |
| InChI Key | OTWVUBYTKJKBBP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=CC(=N2)C3=CN(C=C3)S(=O)(=O)C4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | Quinoxaline, 2-{1-[(4-chlorophenyl)sulfonyl]-1H-pyrrol-3-yl}- |