Systematic / IUPAC Name: N-[3,5-Bis(trifluoromethyl)phenyl]-5-[(E)-phenyldiazenyl]-1,3,4-thiadiazol-2-amine
ID: Reference3656
Other Names: 1,3,4-Thiadiazol-2-amine, N-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-phenyldiazenyl]-
Formula: C16H9F6N5S
N2-[3,5-Bis(trifluoromethyl)phenyl]-5-(2-phenyldiaz-1-enyl)-1,3,4-thiadiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2016 8:17:05 AM |
| InChI | InChI=1S/C16H9F6N5S/c17-15(18,19)9-6-10(16(20,21)22)8-12(7-9)23-13-25-27-14(28-13)26-24-11-4-2-1-3-5-11/h1-8H,(H,23,25)/b26-24+ |
| InChI Key | ZQOIKTKKWDRVPX-SHHOIMCASA-N |
| Canonical SMILES | c1ccc(cc1)/N=N/c2nnc(s2)Nc3cc(cc(c3)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 1,3,4-Thiadiazol-2-amine, N-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-2-phenyldiazenyl]- |
| ChemSpider | 18018042 |