Systematic / IUPAC Name: 4-(2,6-Dichlorobenzyl)-6-(trifluoromethyl)-2H-1,4-benzothiazin-3(4H)-one
ID: Reference3657
Other Names: 2H-1,4-Benzothiazin-3(4H)-one, 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-
Formula: C16H10Cl2F3NOS
4-(2,6-Dichlorobenzyl)-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2016 10:13:41 AM |
| InChI | InChI=1S/C16H10Cl2F3NOS/c17-11-2-1-3-12(18)10(11)7-22-13-6-9(16(19,20)21)4-5-14(13)24-8-15(22)23/h1-6H,7-8H2 |
| InChI Key | LGLQXFOJZBFWKA-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=O)N(C2=C(S1)C=CC(=C2)C(F)(F)F)CC3=C(C=CC=C3Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 2H-1,4-Benzothiazin-3(4H)-one, 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)- |