Systematic / IUPAC Name: N'-{(1E)-2-Cyano-1-[(2,6-dichlorobenzyl)sulfanyl]-3-oxo-1-buten-1-yl}-N,N-dimethylimidoformamide
ID: Reference3660
Other Names: Methanimidamide, N'-((1E)-2-cyano-1-{[(2,6-dichlorophenyl)methyl]thio}-3-oxo-1-buten-1-yl)-N,N-dimethyl-
Formula: C15H15Cl2N3OS
N'-{2-Cyano-1-[(2,6-dichlorobenzyl)sulfanyl]-3-oxo-1-butenyl}-N,N-dimethyliminoformamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 249 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2016 1:11:36 PM |
| InChI | InChI=1S/C15H15Cl2N3OS/c1-10(21)11(7-18)15(19-9-20(2)3)22-8-12-13(16)5-4-6-14(12)17/h4-6,9H,8H2,1-3H3/b15-11+,19-9+ |
| InChI Key | ATAVPZMWOOWDTH-UOTFLDJSSA-N |
| Canonical SMILES | CC(=O)C(=C(N=CN(C)C)SCC1=C(C=CC=C1Cl)Cl)C#N |
| CAS | |
| Splash | |
| Other Names | Methanimidamide, N'-((1E)-2-cyano-1-{[(2,6-dichlorophenyl)methyl]thio}-3-oxo-1-buten-1-yl)-N,N-dimethyl- |