Systematic / IUPAC Name: Ethyl [2-(2-furyl)-4,5-diphenyl-1H-imidazol-1-yl]acetate
ID: Reference3661
Other Names: 1H-Imidazole-1-acetic acid, 2-(2-furanyl)-4,5-diphenyl-, ethyl ester
Formula: C23H20N2O3
Ethyl 2-[2-(2-furyl)-4,5-diphenyl-1H-imidazol-1-yl]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2016 1:36:22 PM |
| InChI | InChI=1S/C23H20N2O3/c1-2-27-20(26)16-25-22(18-12-7-4-8-13-18)21(17-10-5-3-6-11-17)24-23(25)19-14-9-15-28-19/h3-15H,2,16H2,1H3 |
| InChI Key | YEUOIMKZMWFFMC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CN1C(=C(N=C1C2=CC=CO2)C3=CC=CC=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 1H-Imidazole-1-acetic acid, 2-(2-furanyl)-4,5-diphenyl-, ethyl ester |