Systematic / IUPAC Name: Methyl (2E)-2-cyano-3-(dimethylamino)acrylate
ID: Reference3662
Other Names:
Methyl (2E)-2-cyano-3-(dimethylamino)prop-2-enoate;
Methyl (2E)-3-(dimethylamino)-2-cyanoprop-2-enoate;
Methylcyanodimethylaminoacrylate
Formula: C7H10N2O2
Methyl 2-cyano-3-(dimethylamino)acrylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/29/2016 2:17:44 PM |
| InChI | InChI=1S/C7H10N2O2/c1-9(2)5-6(4-8)7(10)11-3/h5H,1-3H3/b6-5+ |
| InChI Key | HWBIEDPFULRCDP-AATRIKPKSA-N |
| Canonical SMILES | CN(C)C=C(C#N)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
Methyl (2E)-2-cyano-3-(dimethylamino)prop-2-enoate; Methyl (2E)-3-(dimethylamino)-2-cyanoprop-2-enoate; Methylcyanodimethylaminoacrylate |
| ChEMBL | CHEMBL1705199 |
| PubChem | 2732123 |
| ChemSpider | 2013944 |