Systematic / IUPAC Name: N'-({[2-(2,3-Dichlorophenyl)-1,3-thiazol-4-yl]carbamoyl}oxy)-4-(trifluoromethyl)benzenecarboximidamide
ID: Reference3663
Other Names: Benzenecarboximidamide, N'-[({[2-(2,3-dichlorophenyl)-4-thiazolyl]amino}carbonyl)oxy]-4-(trifluoromethyl)-
Formula: C18H11Cl2F3N4O2S
N'-[({[2-(2,3-Dichlorophenyl)-1,3-thiazol-4-yl]amino}carbonyl)oxy]-4-(trifluoromethyl)benzenecarboximidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 239 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/1/2016 11:14:15 AM |
| InChI | InChI=1S/C18H11Cl2F3N4O2S/c19-12-3-1-2-11(14(12)20)16-25-13(8-30-16)26-17(28)29-27-15(24)9-4-6-10(7-5-9)18(21,22)23/h1-8H,(H2,24,27)(H,26,28) |
| InChI Key | PZZRRPOXVPCOKP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NC(=CS2)NC(=O)ON=C(C3=CC=C(C=C3)C(F)(F)F)N |
| CAS | |
| Splash | |
| Other Names | Benzenecarboximidamide, N'-[({[2-(2,3-dichlorophenyl)-4-thiazolyl]amino}carbonyl)oxy]-4-(trifluoromethyl)- |