Systematic / IUPAC Name: 1-(4-Fluorophenyl)-3-(1H-indazol-6-yl)thiourea
ID: Reference3665
Other Names: Thiourea, N-(4-fluorophenyl)-N'-1H-indazol-6-yl-
Formula: C14H11FN4S
N-(4-Fluorophenyl)-N'-(1H-indazol-6-yl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 244 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/1/2016 11:42:27 AM |
| InChI | InChI=1S/C14H11FN4S/c15-10-2-5-11(6-3-10)17-14(20)18-12-4-1-9-8-16-19-13(9)7-12/h1-8H,(H,16,19)(H2,17,18,20) |
| InChI Key | WMDYRLAPQORBNC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1NC(=S)NC2=CC3=C(C=C2)C=NN3)F |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-(4-fluorophenyl)-N'-1H-indazol-6-yl- |