Systematic / IUPAC Name: N-(4-Fluorophenyl)-1-(2-furylmethyl)-5-oxo-3-pyrrolidinecarboxamide
ID: Reference3666
Other Names:
N-(4-Fluorophenyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide;
3-Pyrrolidinecarboxamide, N-(4-fluorophenyl)-1-(2-furanylmethyl)-5-oxo-
Formula: C16H15FN2O3
N-(4-Fluorophenyl)-1-(2-furylmethyl)-5-oxo-3-pyrrolidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/1/2016 1:46:55 PM |
| InChI | InChI=1S/C16H15FN2O3/c17-12-3-5-13(6-4-12)18-16(21)11-8-15(20)19(9-11)10-14-2-1-7-22-14/h1-7,11H,8-10H2,(H,18,21) |
| InChI Key | MVVRRYAGIMODTE-UHFFFAOYSA-N |
| Canonical SMILES | C1C(CN(C1=O)CC2=CC=CO2)C(=O)NC3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
N-(4-Fluorophenyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide; 3-Pyrrolidinecarboxamide, N-(4-fluorophenyl)-1-(2-furanylmethyl)-5-oxo- |
| PubChem | 2815710 |
| ChEMBL | CHEMBL1358847 |
| ChemSpider | 2094074 |