Systematic / IUPAC Name: 2-[4-(Benzyloxy)phenoxy]-3-nitropyridine
ID: Reference3671
Other Names: Pyridine, 3-nitro-2-[4-(phenylmethoxy)phenoxy]-
Formula: C18H14N2O4
2-[4-(Benzyloxy)phenoxy]-3-nitropyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2016 1:49:41 PM |
| InChI | InChI=1S/C18H14N2O4/c21-20(22)17-7-4-12-19-18(17)24-16-10-8-15(9-11-16)23-13-14-5-2-1-3-6-14/h1-12H,13H2 |
| InChI Key | ASRRYTJDPMUOHW-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Pyridine, 3-nitro-2-[4-(phenylmethoxy)phenoxy]- |
| PubChem | 2799697 |
| ChemSpider | 2078435 |
| ChEMBL | CHEMBL1485334 |