Systematic / IUPAC Name: 5-Chloro-N-{1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-piperidinyl}-6-methyl-2-(2-pyridinyl)-4-pyrimidinamine
ID: Reference3673
Other Names: 4-Pyrimidinamine, 5-chloro-N-{1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-piperidinyl}-6-methyl-2-(2-pyridinyl)-
Formula: C21H19Cl2F3N6
N-(5-Chloro-6-methyl-2-pyridin-2-ylpyrimidin-4-yl)-N-{1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperidin-4-yl}amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 223 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/2/2016 1:47:03 PM |
| InChI | InChI=1S/C21H19Cl2F3N6/c1-12-17(23)19(31-18(29-12)16-4-2-3-7-27-16)30-14-5-8-32(9-6-14)20-15(22)10-13(11-28-20)21(24,25)26/h2-4,7,10-11,14H,5-6,8-9H2,1H3,(H,29,30,31) |
| InChI Key | NKOKQUJHLXEFFS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NC(=N1)C2=CC=CC=N2)NC3CCN(CC3)C4=C(C=C(C=N4)C(F)(F)F)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 4-Pyrimidinamine, 5-chloro-N-{1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-piperidinyl}-6-methyl-2-(2-pyridinyl)- |
| ChemSpider | 2075124 |
| PubChem | 2796249 |
| ChEMBL | CHEMBL2392772 |