Systematic / IUPAC Name: 3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-one
ID: Reference368
Other Names:
(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one;
3,4,5-Trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-one;
Gluconolactone;
δ-Gluconolactone;
Gluconic acid lactone
; more
Formula: C6H10O6
Class: Endogenous Metabolites Excipients/Additives/Colorants
δ-Gluconic acid δ-lactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1296 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/23/2026 4:08:28 PM |
| InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChI Key | PHOQVHQSTUBQQK-SQOUGZDYSA-N |
| Canonical SMILES | O=C1OC(CO)C(O)C(O)C1O |
| CAS | 90802 |
| Splash | |
| Other Names |
(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one; 3,4,5-Trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-one; Gluconolactone; δ-Gluconolactone; Gluconic acid lactone; Gluconic δ-lactone; D-δ-Gluconolactone; D-Gluconic acid, δ-lactone; Gluconic acid, δ-lactone, D-; Glucono 1,5-lactone; δ-Glucono-δ-lactone; δ-Glucono-1,5-lactone |
| PubChem | 7027 |
| HMDb | HMDB00150 |
| KEGG | C00198; D04332 |
| ChemIDPlus | 000090802 |
| ChEBI | CHEBI:16217 |
| Wikipedia | Glucono delta-lactone |
| ChEMBL | CHEMBL1200829 |
| ChemSpider | 6760 |