Systematic / IUPAC Name: (5-{[(4-Chlorophenyl)sulfanyl]methyl}-2-furyl)(4-morpholinyl)methanone
ID: Reference3680
Other Names: Methanone, (5-{[(4-chlorophenyl)thio]methyl}-2-furanyl)-4-morpholinyl-
Formula: C16H16ClNO3S
(5-{[(4-Chlorophenyl)thio]methyl}-2-furyl)(morpholino)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2016 9:28:45 AM |
| InChI | InChI=1S/C16H16ClNO3S/c17-12-1-4-14(5-2-12)22-11-13-3-6-15(21-13)16(19)18-7-9-20-10-8-18/h1-6H,7-11H2 |
| InChI Key | DGLNYACVQPRBPA-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C(=O)C2=CC=C(O2)CSC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Methanone, (5-{[(4-chlorophenyl)thio]methyl}-2-furanyl)-4-morpholinyl- |
| PubChem | 332581 |
| ChemSpider | 294658 |
| ChEMBL | CHEMBL2130585 |