Systematic / IUPAC Name: 2-[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]-1H-isoindole-1,3(2H)-dione
ID: Reference3681
Other Names: 1H-Isoindole-1,3(2H)-dione, 2-[4-(4-chlorophenyl)-2-thiazolyl]-
Formula: C17H9ClN2O2S
2-[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]isoindoline-1,3-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2016 11:27:55 AM |
| InChI | InChI=1S/C17H9ClN2O2S/c18-11-7-5-10(6-8-11)14-9-23-17(19-14)20-15(21)12-3-1-2-4-13(12)16(20)22/h1-9H |
| InChI Key | ZXYZJLZJIDNEAK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=NC(=CS3)C4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Isoindole-1,3(2H)-dione, 2-[4-(4-chlorophenyl)-2-thiazolyl]- |
| ChemSpider | 2086678 |
| ChEMBL | CHEMBL2356368 |
| PubChem | 2808235 |