Systematic / IUPAC Name: 4-[4-(Benzyloxy)phenyl]-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-2,4-dihydro-3H-1,2,4-triazol-3-one
ID: Reference3686
Other Names: 4-[4-(Benzyloxy)phenyl]-5-[(5-nitro-1,3-thiazol-2-yl)thio]-2,4-dihydro-3H-1,2,4-triazol-3-one
Formula: C18H13N5O4S2
4-[4-(Benzyloxy)phenyl]-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-4,5-dihydro-1H-1,2,4-triazol-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2016 12:14:11 PM |
| InChI | InChI=1S/C18H13N5O4S2/c24-16-20-21-17(29-18-19-10-15(28-18)23(25)26)22(16)13-6-8-14(9-7-13)27-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,20,24) |
| InChI Key | OWFFATZZLMFXGR-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 4-[4-(Benzyloxy)phenyl]-5-[(5-nitro-1,3-thiazol-2-yl)thio]-2,4-dihydro-3H-1,2,4-triazol-3-one |
| ChEMBL | CHEMBL209391 |
| PubChem | 2747116 |
| ChemSpider | 2028565 |