Systematic / IUPAC Name: N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(2-furoyl)hydrazinecarbothioamide
ID: Reference3690
Other Names: 2-Furancarboxylic acid, 2-{[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]thioxomethyl}hydrazide
Formula: C14H13N3O4S
N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(2-furylcarbonyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2016 1:11:06 PM |
| InChI | InChI=1S/C14H13N3O4S/c18-13(11-2-1-5-19-11)16-17-14(22)15-9-3-4-10-12(8-9)21-7-6-20-10/h1-5,8H,6-7H2,(H,16,18)(H2,15,17,22) |
| InChI Key | OYRVMSHIYGBBMH-UHFFFAOYSA-N |
| Canonical SMILES | C1COC2=C(O1)C=CC(=C2)NC(=S)NNC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboxylic acid, 2-{[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]thioxomethyl}hydrazide |