Systematic / IUPAC Name: Methyl 3-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}-2-thiophenecarboxylate
ID: Reference3692
Other Names: 2-Thiophenecarboxylic acid, 3-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}-, methyl ester
Formula: C15H11FN2O4S
Methyl 3-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}thiophene-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2016 2:35:13 PM |
| InChI | InChI=1S/C15H11FN2O4S/c1-20-15(19)13-11(6-7-23-13)21-8-12-17-18-14(22-12)9-2-4-10(16)5-3-9/h2-7H,8H2,1H3 |
| InChI Key | GVZPQFISEONNOD-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=C(C=CS1)OCC2=NN=C(O2)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, 3-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}-, methyl ester |