Systematic / IUPAC Name: 3,4-Diphenylpyrimido[4',5':4,5]thieno[2,3-c]pyridazin-8(5H)-one
ID: Reference3696
Other Names: Pyrimido[4',5':4,5]thieno[2,3-c]pyridazin-8(5H)-one, 3,4-diphenyl-
Formula: C20H12N4OS
3,4-Diphenylpyrimido[4',5':4,5]thieno[2,3-c]pyridazin-8(7H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/4/2016 9:51:15 AM |
| InChI | InChI=1S/C20H12N4OS/c25-19-18-17(21-11-22-19)15-14(12-7-3-1-4-8-12)16(23-24-20(15)26-18)13-9-5-2-6-10-13/h1-11H,(H,21,22,25) |
| InChI Key | XORFIPIPEHWMLI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C3C4=C(C(=O)N=CN4)SC3=NN=C2C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | Pyrimido[4',5':4,5]thieno[2,3-c]pyridazin-8(5H)-one, 3,4-diphenyl- |