Systematic / IUPAC Name: (2E)-3-{[3,5-Bis(trifluoromethyl)phenyl]amino}-2-(2-thienylsulfonyl)acrylonitrile
ID: Reference3697
Other Names: 2-Propenenitrile, 3-{[3,5-bis(trifluoromethyl)phenyl]amino}-2-(2-thienylsulfonyl)-, (2E)-
Formula: C15H8F6N2O2S2
3-[3,5-bis(trifluoromethyl)anilino]-2-(2-thienylsulfonyl)acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/4/2016 9:16:20 AM |
| InChI | InChI=1S/C15H8F6N2O2S2/c16-14(17,18)9-4-10(15(19,20)21)6-11(5-9)23-8-12(7-22)27(24,25)13-2-1-3-26-13/h1-6,8,23H/b12-8+ |
| InChI Key | YJIARGCSGVFVGN-XYOKQWHBSA-N |
| Canonical SMILES | C1=CSC(=C1)S(=O)(=O)C(=CNC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names | 2-Propenenitrile, 3-{[3,5-bis(trifluoromethyl)phenyl]amino}-2-(2-thienylsulfonyl)-, (2E)- |