Systematic / IUPAC Name: 3-(3-Chlorophenyl)-5-phenyl-1H-1,2,4-triazole
ID: Reference3708
Other Names: 1H-1,2,4-Triazole, 3-(3-chlorophenyl)-5-phenyl-
Formula: C14H10ClN3
3-(3-Chlorophenyl)-5-phenyl-1H-1,2,4-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 197 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/4/2016 12:38:10 PM |
| InChI | InChI=1S/C14H10ClN3/c15-12-8-4-7-11(9-12)14-16-13(17-18-14)10-5-2-1-3-6-10/h1-9H,(H,16,17,18) |
| InChI Key | IHRPRJDMHMNMII-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC(=NN2)C3=CC(=CC=C3)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-1,2,4-Triazole, 3-(3-chlorophenyl)-5-phenyl- |