Systematic / IUPAC Name: 1-Methyl-4-nitro-5-(2-thienylsulfanyl)-1H-imidazole
ID: Reference3709
Other Names: 1H-Imidazole, 1-methyl-4-nitro-5-(2-thienylthio)-
Formula: C8H7N3O2S2
1-Methyl-4-nitro-5-(2-thienylthio)-1H-imidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/4/2016 12:39:24 PM |
| InChI | InChI=1S/C8H7N3O2S2/c1-10-5-9-7(11(12)13)8(10)15-6-3-2-4-14-6/h2-5H,1H3 |
| InChI Key | XQHOWZXCDFTVST-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 1H-Imidazole, 1-methyl-4-nitro-5-(2-thienylthio)- |