Systematic / IUPAC Name: 1-(3-Chloro-4-fluorophenyl)-3-(3-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea
ID: Reference3712
Other Names:
N-(3-Chloro-4-fluorophenyl)-N'-(3-chlorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea ;
Urea, N-(3-chloro-4-fluorophenyl)-N'-(3-chlorophenyl)-N-(4,5-dihydro-5-methyl-2-thiazolyl)-
Formula: C17H14Cl2FN3OS
1-(3-Chloro-4-fluorophenyl)-3-(3-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 151 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 6:29:42 AM |
| InChI | InChI=1S/C17H14Cl2FN3OS/c1-10-9-21-17(25-10)23(13-5-6-15(20)14(19)8-13)16(24)22-12-4-2-3-11(18)7-12/h2-8,10H,9H2,1H3,(H,22,24) |
| InChI Key | WFUONJZPYMWRSB-UHFFFAOYSA-N |
| Canonical SMILES | CC1CN=C(S1)N(C2=CC(=C(C=C2)F)Cl)C(=O)NC3=CC(=CC=C3)Cl |
| CAS | |
| Splash | |
| Other Names |
N-(3-Chloro-4-fluorophenyl)-N'-(3-chlorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea ; Urea, N-(3-chloro-4-fluorophenyl)-N'-(3-chlorophenyl)-N-(4,5-dihydro-5-methyl-2-thiazolyl)- |