Systematic / IUPAC Name: 2-{[2-(1-Benzofuran-2-yl)-2-oxoethyl]sulfanyl}-4(1H)-quinazolinone
ID: Reference3726
Other Names: 4(1H)-Quinazolinone, 2-{[2-(2-benzofuranyl)-2-oxoethyl]thio}-
Formula: C18H12N2O3S
2-{[2-(1-Benzofuran-2-yl)-2-oxoethyl]thio}quinazolin-4(3H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 12:26:16 PM |
| InChI | InChI=1S/C18H12N2O3S/c21-14(16-9-11-5-1-4-8-15(11)23-16)10-24-18-19-13-7-3-2-6-12(13)17(22)20-18/h1-9H,10H2,(H,19,20,22) |
| InChI Key | WREXXVBJCLSNOB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)CSC3=NC(=O)C4=CC=CC=C4N3 |
| CAS | |
| Splash | |
| Other Names | 4(1H)-Quinazolinone, 2-{[2-(2-benzofuranyl)-2-oxoethyl]thio}- |