Systematic / IUPAC Name: 5-(Methylsulfanyl)-N-{[3-(trifluoromethyl)phenyl]carbamoyl}-2-thiophenecarboxamide
ID: Reference3727
Other Names: N-{[5-(Methylthio)-2-thienyl]carbonyl}-N'-[3-(trifluoromethyl)phenyl]urea
Formula: C14H11F3N2O2S2
N-{[5-(Methylthio)-2-thienyl]carbonyl}-N'-[3-(trifluoromethyl)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/5/2016 1:11:24 PM |
| InChI | InChI=1S/C14H11F3N2O2S2/c1-22-11-6-5-10(23-11)12(20)19-13(21)18-9-4-2-3-8(7-9)14(15,16)17/h2-7H,1H3,(H2,18,19,20,21) |
| InChI Key | RFQONSZJDBOVLY-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=C(S1)C(=O)NC(=O)NC2=CC=CC(=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | N-{[5-(Methylthio)-2-thienyl]carbonyl}-N'-[3-(trifluoromethyl)phenyl]urea |