Systematic / IUPAC Name: 2-{[2-(4-Chlorophenyl)-2-oxoethyl]sulfanyl}-6-methyl-5-(3-methylbutyl)-4(1H)-pyrimidinone
ID: Reference3734
Other Names: 2-(4-Chlorophenacylthio)-4-hydroxy-6-methyl-5-(3-methylbutyl)pyrimidine
Formula: C18H21ClN2O2S
1-(4-Chlorophenyl)-2-[(4-hydroxy-5-isopentyl-6-methylpyrimidin-2-yl)thio]ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 8:12:53 AM |
| InChI | InChI=1S/C18H21ClN2O2S/c1-11(2)4-9-15-12(3)20-18(21-17(15)23)24-10-16(22)13-5-7-14(19)8-6-13/h5-8,11H,4,9-10H2,1-3H3,(H,20,21,23) |
| InChI Key | KVCAWVYRZLEJJV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=O)N=C(N1)SCC(=O)C2=CC=C(C=C2)Cl)CCC(C)C |
| CAS | |
| Splash | |
| Other Names | 2-(4-Chlorophenacylthio)-4-hydroxy-6-methyl-5-(3-methylbutyl)pyrimidine |