Systematic / IUPAC Name: N'-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-methylpropanehydrazide
ID: Reference3735
Other Names:
N'1-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-2-methylpropanohydrazide ;
Propanoic acid, 2-methyl, 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazide
Formula: C10H11ClF3N3O
N'1-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-2-methylpropanohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 228 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 8:19:12 AM |
| InChI | InChI=1S/C10H11ClF3N3O/c1-5(2)9(18)17-16-8-7(11)3-6(4-15-8)10(12,13)14/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChI Key | LEZVKPBMDRMVIG-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C(=O)NNC1=C(C=C(C=N1)C(F)(F)F)Cl |
| CAS | |
| Splash | |
| Other Names |
N'1-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-2-methylpropanohydrazide ; Propanoic acid, 2-methyl, 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazide |