Systematic / IUPAC Name: 6,7-Dimethoxy-1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3,4-dihydroisoquinoline
ID: Reference3743
Other Names: Isoquinoline, 3,4-dihydro-6,7-dimethoxy-1-(5-methyl-3-phenyl-4-isoxazolyl)-
Formula: C21H20N2O3
4-(6,7-Dimethoxy-3,4-dihydroisoquinolin-1-yl)-5-methyl-3-phenylisoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 12:24:24 PM |
| InChI | InChI=1S/C21H20N2O3/c1-13-19(20(23-26-13)14-7-5-4-6-8-14)21-16-12-18(25-3)17(24-2)11-15(16)9-10-22-21/h4-8,11-12H,9-10H2,1-3H3 |
| InChI Key | GSNGPIFGSDKLIH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=NCCC4=CC(=C(C=C43)OC)OC |
| CAS | |
| Splash | |
| Other Names | Isoquinoline, 3,4-dihydro-6,7-dimethoxy-1-(5-methyl-3-phenyl-4-isoxazolyl)- |