Systematic / IUPAC Name: N-{2-[(2-Aminophenyl)sulfanyl]-5-nitrophenyl}acetamide
ID: Reference3744
Other Names: Acetamide, N-{2-[(2-aminophenyl)thio]-5-nitrophenyl}-
Formula: C14H13N3O3S
N-1-{2-[(2-Aminophenyl)thio]-5-nitrophenyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 1:13:56 PM |
| InChI | InChI=1S/C14H13N3O3S/c1-9(18)16-12-8-10(17(19)20)6-7-14(12)21-13-5-3-2-4-11(13)15/h2-8H,15H2,1H3,(H,16,18) |
| InChI Key | QABFRATXHNDZJB-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-{2-[(2-aminophenyl)thio]-5-nitrophenyl}- |