Systematic / IUPAC Name: 5-Phenyl-4-(1-piperazinyl)thieno[2,3-d]pyrimidine
ID: Reference3748
Other Names: 5-Phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine
Formula: C16H16N4S
5-Phenyl-4-piperazinothieno[2,3-d]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/8/2016 2:21:17 PM |
| InChI | InChI=1S/C16H16N4S/c1-2-4-12(5-3-1)13-10-21-16-14(13)15(18-11-19-16)20-8-6-17-7-9-20/h1-5,10-11,17H,6-9H2 |
| InChI Key | CROSIIFKOPCIFE-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1)C2=C3C(=CSC3=NC=N2)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 5-Phenyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine |