Systematic / IUPAC Name: 2-(2-Aminopropanoylamino)propanoic acid
ID: Reference375
Other Names:
(R)-2-((R)-2-Aminopropanamido)propanoic acid;
D-Ala-D-Ala;
D-Alanine, D-alanyl-
Formula: C6H12N2O3
Class: Endogenous Metabolites
D-Alanyl-D-alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 154 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/9/2015 1:21:25 PM |
| InChI | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m1/s1 |
| InChI Key | DEFJQIDDEAULHB-QWWZWVQMSA-N |
| Canonical SMILES | CC(C(=O)NC(C)C(=O)O)N |
| CAS | 2867201 |
| Splash | |
| Other Names |
(R)-2-((R)-2-Aminopropanamido)propanoic acid; D-Ala-D-Ala; D-Alanine, D-alanyl- |
| ChemSpider | 4573916 |
| ChEMBL | CHEMBL299420 |
| ChEBI | CHEBI:16576; CHEBI:57822 |
| KEGG | C00993 |
| HMDb | HMDB03459 |
| PubChem | 5460362 |