Systematic / IUPAC Name: 2-(3-Cyclohexen-1-yl)-6-[(3-methoxypropyl)amino]-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile
ID: Reference3751
Other Names: 2-Cyclohex-3-enyl-6-[(3-methoxypropyl)amino]-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile
Formula: C15H21N3O2S
2-Cyclohex-3-enyl-6-[(3-methoxypropyl)amino]-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2016 8:44:49 AM |
| InChI | InChI=1S/C15H21N3O2S/c1-20-9-5-8-17-15-12(10-16)13(19)18-14(21-15)11-6-3-2-4-7-11/h2-3,11,14,17H,4-9H2,1H3,(H,18,19) |
| InChI Key | FYMAMLRHQSQGIK-UHFFFAOYSA-N |
| Canonical SMILES | COCCCNC1=C(C(=O)NC(S1)C2CCC=CC2)C#N |
| CAS | |
| Splash | |
| Other Names | 2-Cyclohex-3-enyl-6-[(3-methoxypropyl)amino]-4-oxo-3,4-dihydro-2H-1,3-thiazine-5-carbonitrile |