Systematic / IUPAC Name: N,N'-Bis(3-pyridinyl)pentanediamide
ID: Reference3755
Other Names:
N-(3-Pyridyl)-N'-(3-pyridyl)pentane-1,5-diamide ;
N,N'-Bis(pyridin-3-yl)pentanediamide
Formula: C15H16N4O2
N1,N5-Bis(3-pyridinyl)pentanediamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2016 8:51:03 AM |
| InChI | InChI=1S/C15H16N4O2/c20-14(18-12-4-2-8-16-10-12)6-1-7-15(21)19-13-5-3-9-17-11-13/h2-5,8-11H,1,6-7H2,(H,18,20)(H,19,21) |
| InChI Key | QTWONMVWUFTWDU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CN=C1)NC(=O)CCCC(=O)NC2=CN=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
N-(3-Pyridyl)-N'-(3-pyridyl)pentane-1,5-diamide ; N,N'-Bis(pyridin-3-yl)pentanediamide |
| ChemSpider | 636619 |
| PubChem | 728924 |
| ChEMBL | CHEMBL1363709 |